C25H23NO6 — CID 70444197
3-(1,2-diphenylethoxy)-3-oxo-2-(phenylmethoxycarbonylamino)propanoic acid (PubChem CID 70444197) has the molecular formula C25H23NO6 and a molecular weight of 433.46 g/mol. Its IUPAC name is 3-(1,2-diphenylethoxy)-3-oxo-2-(phenylmethoxycarbonylamino)propanoic acid.
| Compound Name | 3-(1,2-diphenylethoxy)-3-oxo-2-(phenylmethoxycarbonylamino)propanoic acid |
|---|---|
| PubChem CID | 70444197 |
| Molecular Formula | C25H23NO6 |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | 3-(1,2-diphenylethoxy)-3-oxo-2-(phenylmethoxycarbonylamino)propanoic acid |
| SMILES | O=C(NC(C(=O)O)C(=O)OC(Cc1ccccc1)c1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C25H23NO6/c27-23(28)22(26-25(30)31-17-19-12-6-2-7-13-19)24(29)32-21(20-14-8-3-9-15-20)16-18-10-4-1-5-11-18/h1-15,21-22H,16-17H2,(H,26,30)(H,27,28) |
| InChIKey | OHZWYCZQLFYLAG-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|