C29H32BrNO4 — CID 18655493
[(2S,3R,4S)-2-bromo-1-(3,5-dimethylphenyl)-5-phenyl-4-(phenylmethoxycarbonylamino)pentan-3-yl] acetate (PubChem CID 18655493) has the molecular formula C29H32BrNO4 and a molecular weight of 538.48 g/mol. Its IUPAC name is [(2S,3R,4S)-2-bromo-1-(3,5-dimethylphenyl)-5-phenyl-4-(phenylmethoxycarbonylamino)pentan-3-yl] acetate.
| Compound Name | [(2S,3R,4S)-2-bromo-1-(3,5-dimethylphenyl)-5-phenyl-4-(phenylmethoxycarbonylamino)pentan-3-yl] acetate |
|---|---|
| PubChem CID | 18655493 |
| Molecular Formula | C29H32BrNO4 |
| Molecular Weight | 538.48 g/mol |
| Exact Mass | 537.15 |
| IUPAC Name | [(2S,3R,4S)-2-bromo-1-(3,5-dimethylphenyl)-5-phenyl-4-(phenylmethoxycarbonylamino)pentan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]([C@H](Cc1ccccc1)NC(=O)OCc1ccccc1)[C@@H](Br)Cc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C29H32BrNO4/c1-20-14-21(2)16-25(15-20)17-26(30)28(35-22(3)32)27(18-23-10-6-4-7-11-23)31-29(33)34-19-24-12-8-5-9-13-24/h4-16,26-28H,17-19H2,1-3H3,(H,31,33)/t26-,27-,28-/m0/s1 |
| InChIKey | RYIIYKUIHGUZQA-KCHLEUMXSA-N |
| XLogP | 6.08 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.48 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|