C15H18F3N3O2 — CID 123614837
benzyl 4-(2,2,2-trifluoroethylhydrazinylidene)piperidine-1-carboxylate (PubChem CID 123614837) has the molecular formula C15H18F3N3O2 and a molecular weight of 329.32 g/mol. Its IUPAC name is benzyl 4-(2,2,2-trifluoroethylhydrazinylidene)piperidine-1-carboxylate.
| Compound Name | benzyl 4-(2,2,2-trifluoroethylhydrazinylidene)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 123614837 |
| Molecular Formula | C15H18F3N3O2 |
| Molecular Weight | 329.32 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | benzyl 4-(2,2,2-trifluoroethylhydrazinylidene)piperidine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCC(=NNCC(F)(F)F)CC1 |
| InChI | InChI=1S/C15H18F3N3O2/c16-15(17,18)11-19-20-13-6-8-21(9-7-13)14(22)23-10-12-4-2-1-3-5-12/h1-5,19H,6-11H2 |
| InChIKey | CFFYPJZJVJYKPO-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.32 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|