C16H17F3N2O4 — CID 87446866
benzyl 4-(2,2,4-trifluoro-3-oxobutanoyl)piperazine-1-carboxylate (PubChem CID 87446866) has the molecular formula C16H17F3N2O4 and a molecular weight of 358.32 g/mol. Its IUPAC name is benzyl 4-(2,2,4-trifluoro-3-oxobutanoyl)piperazine-1-carboxylate.
| Compound Name | benzyl 4-(2,2,4-trifluoro-3-oxobutanoyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 87446866 |
| Molecular Formula | C16H17F3N2O4 |
| Molecular Weight | 358.32 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | benzyl 4-(2,2,4-trifluoro-3-oxobutanoyl)piperazine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCN(C(=O)C(F)(F)C(=O)CF)CC1 |
| InChI | InChI=1S/C16H17F3N2O4/c17-10-13(22)16(18,19)14(23)20-6-8-21(9-7-20)15(24)25-11-12-4-2-1-3-5-12/h1-5H,6-11H2 |
| InChIKey | LDZCAESFQCAOAZ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.32 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|