C33H33NO4SSi — CID 11467213
4-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-(4-methylphenyl)sulfonylindole-3-carbaldehyde (PubChem CID 11467213) has the molecular formula C33H33NO4SSi and a molecular weight of 567.78 g/mol. Its IUPAC name is 4-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-(4-methylphenyl)sulfonylindole-3-carbaldehyde.
| Compound Name | 4-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-(4-methylphenyl)sulfonylindole-3-carbaldehyde |
|---|---|
| PubChem CID | 11467213 |
| Molecular Formula | C33H33NO4SSi |
| Molecular Weight | 567.78 g/mol |
| Exact Mass | 567.19 |
| IUPAC Name | 4-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-(4-methylphenyl)sulfonylindole-3-carbaldehyde |
| SMILES | Cc1ccc(S(=O)(=O)n2cc(C=O)c3c(CO[Si](c4ccccc4)(c4ccccc4)C(C)(C)C)cccc32)cc1 |
| InChI | InChI=1S/C33H33NO4SSi/c1-25-18-20-28(21-19-25)39(36,37)34-22-27(23-35)32-26(12-11-17-31(32)34)24-38-40(33(2,3)4,29-13-7-5-8-14-29)30-15-9-6-10-16-30/h5-23H,24H2,1-4H3 |
| InChIKey | HKHDYNTZICRPQQ-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 65.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.78 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|