C36H38N2O3SSi — CID 11678853
N-[2-[1-[3-[tert-butyl(diphenyl)silyl]oxyprop-1-ynyl]indol-3-yl]ethyl]-4-methylbenzenesulfonamide (PubChem CID 11678853) has the molecular formula C36H38N2O3SSi and a molecular weight of 606.86 g/mol. Its IUPAC name is N-[2-[1-[3-[tert-butyl(diphenyl)silyl]oxyprop-1-ynyl]indol-3-yl]ethyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[2-[1-[3-[tert-butyl(diphenyl)silyl]oxyprop-1-ynyl]indol-3-yl]ethyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 11678853 |
| Molecular Formula | C36H38N2O3SSi |
| Molecular Weight | 606.86 g/mol |
| Exact Mass | 606.24 |
| IUPAC Name | N-[2-[1-[3-[tert-butyl(diphenyl)silyl]oxyprop-1-ynyl]indol-3-yl]ethyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCc2cn(C#CCO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)c3ccccc23)cc1 |
| InChI | InChI=1S/C36H38N2O3SSi/c1-29-20-22-31(23-21-29)42(39,40)37-25-24-30-28-38(35-19-12-11-18-34(30)35)26-13-27-41-43(36(2,3)4,32-14-7-5-8-15-32)33-16-9-6-10-17-33/h5-12,14-23,28,37H,24-25,27H2,1-4H3 |
| InChIKey | YCXANQUMSHZFOM-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.86 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|