C18H16BrNO2S — CID 11280729
3-bromo-1-(4-methylphenyl)sulfonyl-4-prop-2-enylindole (PubChem CID 11280729) has the molecular formula C18H16BrNO2S and a molecular weight of 390.30 g/mol. Its IUPAC name is 3-bromo-1-(4-methylphenyl)sulfonyl-4-prop-2-enylindole.
| Compound Name | 3-bromo-1-(4-methylphenyl)sulfonyl-4-prop-2-enylindole |
|---|---|
| PubChem CID | 11280729 |
| Molecular Formula | C18H16BrNO2S |
| Molecular Weight | 390.30 g/mol |
| Exact Mass | 389.01 |
| IUPAC Name | 3-bromo-1-(4-methylphenyl)sulfonyl-4-prop-2-enylindole |
| SMILES | C=CCc1cccc2c1c(Br)cn2S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H16BrNO2S/c1-3-5-14-6-4-7-17-18(14)16(19)12-20(17)23(21,22)15-10-8-13(2)9-11-15/h3-4,6-12H,1,5H2,2H3 |
| InChIKey | YWACOYHHVZWEIP-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.30 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|