C17H12Br3NO2S — CID 53375363
4-bromo-3-(2,2-dibromoethenyl)-1-(4-methylphenyl)sulfonylindole (PubChem CID 53375363) has the molecular formula C17H12Br3NO2S and a molecular weight of 534.07 g/mol. Its IUPAC name is 4-bromo-3-(2,2-dibromoethenyl)-1-(4-methylphenyl)sulfonylindole.
| Compound Name | 4-bromo-3-(2,2-dibromoethenyl)-1-(4-methylphenyl)sulfonylindole |
|---|---|
| PubChem CID | 53375363 |
| Molecular Formula | C17H12Br3NO2S |
| Molecular Weight | 534.07 g/mol |
| Exact Mass | 530.81 |
| IUPAC Name | 4-bromo-3-(2,2-dibromoethenyl)-1-(4-methylphenyl)sulfonylindole |
| SMILES | Cc1ccc(S(=O)(=O)n2cc(C=C(Br)Br)c3c(Br)cccc32)cc1 |
| InChI | InChI=1S/C17H12Br3NO2S/c1-11-5-7-13(8-6-11)24(22,23)21-10-12(9-16(19)20)17-14(18)3-2-4-15(17)21/h2-10H,1H3 |
| InChIKey | ARCGSWMTDVFXLN-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.07 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |