C24H25BrN2O5S — CID 101487409
methyl 3-[acetyl(prop-2-enyl)amino]-3-[4-bromo-1-(4-methylphenyl)sulfonylindol-3-yl]propanoate (PubChem CID 101487409) has the molecular formula C24H25BrN2O5S and a molecular weight of 533.44 g/mol. Its IUPAC name is methyl 3-[acetyl(prop-2-enyl)amino]-3-[4-bromo-1-(4-methylphenyl)sulfonylindol-3-yl]propanoate.
| Compound Name | methyl 3-[acetyl(prop-2-enyl)amino]-3-[4-bromo-1-(4-methylphenyl)sulfonylindol-3-yl]propanoate |
|---|---|
| PubChem CID | 101487409 |
| Molecular Formula | C24H25BrN2O5S |
| Molecular Weight | 533.44 g/mol |
| Exact Mass | 532.07 |
| IUPAC Name | methyl 3-[acetyl(prop-2-enyl)amino]-3-[4-bromo-1-(4-methylphenyl)sulfonylindol-3-yl]propanoate |
| SMILES | C=CCN(C(C)=O)C(CC(=O)OC)c1cn(S(=O)(=O)c2ccc(C)cc2)c2cccc(Br)c12 |
| InChI | InChI=1S/C24H25BrN2O5S/c1-5-13-26(17(3)28)22(14-23(29)32-4)19-15-27(21-8-6-7-20(25)24(19)21)33(30,31)18-11-9-16(2)10-12-18/h5-12,15,22H,1,13-14H2,2-4H3 |
| InChIKey | SMNLKIIAHDLNCN-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 85.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.44 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|