C26H26BrN3O7S2 — CID 25111393
N-[(1R)-1-[3-bromo-1-(4-methylphenyl)sulfonylindol-4-yl]-3-hydroxy-3-methylbutyl]-2-nitrobenzenesulfonamide (PubChem CID 25111393) has the molecular formula C26H26BrN3O7S2 and a molecular weight of 636.55 g/mol. Its IUPAC name is N-[(1R)-1-[3-bromo-1-(4-methylphenyl)sulfonylindol-4-yl]-3-hydroxy-3-methylbutyl]-2-nitrobenzenesulfonamide.
| Compound Name | N-[(1R)-1-[3-bromo-1-(4-methylphenyl)sulfonylindol-4-yl]-3-hydroxy-3-methylbutyl]-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 25111393 |
| Molecular Formula | C26H26BrN3O7S2 |
| Molecular Weight | 636.55 g/mol |
| Exact Mass | 635.04 |
| IUPAC Name | N-[(1R)-1-[3-bromo-1-(4-methylphenyl)sulfonylindol-4-yl]-3-hydroxy-3-methylbutyl]-2-nitrobenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)n2cc(Br)c3c([C@@H](CC(C)(C)O)NS(=O)(=O)c4ccccc4[N+](=O)[O-])cccc32)cc1 |
| InChI | InChI=1S/C26H26BrN3O7S2/c1-17-11-13-18(14-12-17)39(36,37)29-16-20(27)25-19(7-6-9-23(25)29)21(15-26(2,3)31)28-38(34,35)24-10-5-4-8-22(24)30(32)33/h4-14,16,21,28,31H,15H2,1-3H3/t21-/m1/s1 |
| InChIKey | FIBVNEBQUXUPST-OAQYLSRUSA-N |
| XLogP | 5.04 |
| TPSA | 148.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.55 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|