C28H33N3O4SSi — CID 10896792
N-[[1-[tert-butyl(dimethyl)silyl]indol-3-yl]-(2-nitrophenyl)methyl]-4-methylbenzenesulfonamide (PubChem CID 10896792) has the molecular formula C28H33N3O4SSi and a molecular weight of 535.74 g/mol. Its IUPAC name is N-[[1-[tert-butyl(dimethyl)silyl]indol-3-yl]-(2-nitrophenyl)methyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[[1-[tert-butyl(dimethyl)silyl]indol-3-yl]-(2-nitrophenyl)methyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 10896792 |
| Molecular Formula | C28H33N3O4SSi |
| Molecular Weight | 535.74 g/mol |
| Exact Mass | 535.20 |
| IUPAC Name | N-[[1-[tert-butyl(dimethyl)silyl]indol-3-yl]-(2-nitrophenyl)methyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(c2ccccc2[N+](=O)[O-])c2cn([Si](C)(C)C(C)(C)C)c3ccccc23)cc1 |
| InChI | InChI=1S/C28H33N3O4SSi/c1-20-15-17-21(18-16-20)36(34,35)29-27(23-12-8-10-14-26(23)31(32)33)24-19-30(37(5,6)28(2,3)4)25-13-9-7-11-22(24)25/h7-19,27,29H,1-6H3 |
| InChIKey | VLPSMRVCBRXSPM-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 94.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.74 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|