C31H35N3O2SSi — CID 10875240
N-[[1-[tert-butyl(dimethyl)silyl]indol-3-yl]-quinolin-2-ylmethyl]-4-methylbenzenesulfonamide (PubChem CID 10875240) has the molecular formula C31H35N3O2SSi and a molecular weight of 541.79 g/mol. Its IUPAC name is N-[[1-[tert-butyl(dimethyl)silyl]indol-3-yl]-quinolin-2-ylmethyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[[1-[tert-butyl(dimethyl)silyl]indol-3-yl]-quinolin-2-ylmethyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 10875240 |
| Molecular Formula | C31H35N3O2SSi |
| Molecular Weight | 541.79 g/mol |
| Exact Mass | 541.22 |
| IUPAC Name | N-[[1-[tert-butyl(dimethyl)silyl]indol-3-yl]-quinolin-2-ylmethyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(c2ccc3ccccc3n2)c2cn([Si](C)(C)C(C)(C)C)c3ccccc23)cc1 |
| InChI | InChI=1S/C31H35N3O2SSi/c1-22-15-18-24(19-16-22)37(35,36)33-30(28-20-17-23-11-7-9-13-27(23)32-28)26-21-34(38(5,6)31(2,3)4)29-14-10-8-12-25(26)29/h7-21,30,33H,1-6H3 |
| InChIKey | PXYVAWIYUODGDU-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.79 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|