C28H40N2SSi2 — CID 134865309
tert-butyl-[3-[1-[tert-butyl(dimethyl)silyl]indol-3-yl]sulfanylindol-1-yl]-dimethylsilane (PubChem CID 134865309) has the molecular formula C28H40N2SSi2 and a molecular weight of 492.88 g/mol. Its IUPAC name is tert-butyl-[3-[1-[tert-butyl(dimethyl)silyl]indol-3-yl]sulfanylindol-1-yl]-dimethylsilane.
| Compound Name | tert-butyl-[3-[1-[tert-butyl(dimethyl)silyl]indol-3-yl]sulfanylindol-1-yl]-dimethylsilane |
|---|---|
| PubChem CID | 134865309 |
| Molecular Formula | C28H40N2SSi2 |
| Molecular Weight | 492.88 g/mol |
| Exact Mass | 492.25 |
| IUPAC Name | tert-butyl-[3-[1-[tert-butyl(dimethyl)silyl]indol-3-yl]sulfanylindol-1-yl]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)n1cc(Sc2cn([Si](C)(C)C(C)(C)C)c3ccccc23)c2ccccc21 |
| InChI | InChI=1S/C28H40N2SSi2/c1-27(2,3)32(7,8)29-19-25(21-15-11-13-17-23(21)29)31-26-20-30(33(9,10)28(4,5)6)24-18-14-12-16-22(24)26/h11-20H,1-10H3 |
| InChIKey | SUDPKCLWAHQYFJ-UHFFFAOYSA-N |
| XLogP | 9.45 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.88 |
| LogP ≤ 5 | 9.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|