C27H38N2O2Si — CID 23249188
benzyl 2-[[1-[tert-butyl(dimethyl)silyl]indol-4-yl]-methylamino]-3-methylbutanoate (PubChem CID 23249188) has the molecular formula C27H38N2O2Si and a molecular weight of 450.70 g/mol. Its IUPAC name is benzyl 2-[[1-[tert-butyl(dimethyl)silyl]indol-4-yl]-methylamino]-3-methylbutanoate.
| Compound Name | benzyl 2-[[1-[tert-butyl(dimethyl)silyl]indol-4-yl]-methylamino]-3-methylbutanoate |
|---|---|
| PubChem CID | 23249188 |
| Molecular Formula | C27H38N2O2Si |
| Molecular Weight | 450.70 g/mol |
| Exact Mass | 450.27 |
| IUPAC Name | benzyl 2-[[1-[tert-butyl(dimethyl)silyl]indol-4-yl]-methylamino]-3-methylbutanoate |
| SMILES | CC(C)C(C(=O)OCc1ccccc1)N(C)c1cccc2c1ccn2[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H38N2O2Si/c1-20(2)25(26(30)31-19-21-13-10-9-11-14-21)28(6)23-15-12-16-24-22(23)17-18-29(24)32(7,8)27(3,4)5/h9-18,20,25H,19H2,1-8H3 |
| InChIKey | KQPOPHPNHOYPMZ-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.70 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|