C21H28N2O2 — CID 126567137
benzyl (2S)-2-[2-(4-aminophenyl)ethyl-methylamino]-3-methylbutanoate (PubChem CID 126567137) has the molecular formula C21H28N2O2 and a molecular weight of 340.47 g/mol. Its IUPAC name is benzyl (2S)-2-[2-(4-aminophenyl)ethyl-methylamino]-3-methylbutanoate.
| Compound Name | benzyl (2S)-2-[2-(4-aminophenyl)ethyl-methylamino]-3-methylbutanoate |
|---|---|
| PubChem CID | 126567137 |
| Molecular Formula | C21H28N2O2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | benzyl (2S)-2-[2-(4-aminophenyl)ethyl-methylamino]-3-methylbutanoate |
| SMILES | CC(C)[C@@H](C(=O)OCc1ccccc1)N(C)CCc1ccc(N)cc1 |
| InChI | InChI=1S/C21H28N2O2/c1-16(2)20(21(24)25-15-18-7-5-4-6-8-18)23(3)14-13-17-9-11-19(22)12-10-17/h4-12,16,20H,13-15,22H2,1-3H3/t20-/m0/s1 |
| InChIKey | JBQVWZDVLUJFIP-FQEVSTJZSA-N |
| XLogP | 3.51 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|