C29H41N5O5 — CID 123802560
benzyl 2-[2-[4-[[2-acetamido-5-(carbamoylamino)pentanoyl]amino]phenyl]ethyl-methylamino]-3-methylbutanoate (PubChem CID 123802560) has the molecular formula C29H41N5O5 and a molecular weight of 539.68 g/mol. Its IUPAC name is benzyl 2-[2-[4-[[2-acetamido-5-(carbamoylamino)pentanoyl]amino]phenyl]ethyl-methylamino]-3-methylbutanoate.
| Compound Name | benzyl 2-[2-[4-[[2-acetamido-5-(carbamoylamino)pentanoyl]amino]phenyl]ethyl-methylamino]-3-methylbutanoate |
|---|---|
| PubChem CID | 123802560 |
| Molecular Formula | C29H41N5O5 |
| Molecular Weight | 539.68 g/mol |
| Exact Mass | 539.31 |
| IUPAC Name | benzyl 2-[2-[4-[[2-acetamido-5-(carbamoylamino)pentanoyl]amino]phenyl]ethyl-methylamino]-3-methylbutanoate |
| SMILES | CC(=O)NC(CCCNC(N)=O)C(=O)Nc1ccc(CCN(C)C(C(=O)OCc2ccccc2)C(C)C)cc1 |
| InChI | InChI=1S/C29H41N5O5/c1-20(2)26(28(37)39-19-23-9-6-5-7-10-23)34(4)18-16-22-12-14-24(15-13-22)33-27(36)25(32-21(3)35)11-8-17-31-29(30)38/h5-7,9-10,12-15,20,25-26H,8,11,16-19H2,1-4H3,(H,32,35)(H,33,36)(H3,30,31,38) |
| InChIKey | CATVLMUEFYDVKY-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 142.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.68 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|