C25H42N8O6 — CID 163368952
[4-[[(2S)-5-(carbamoylamino)-2-[[(2S)-2-hydrazinyl-3-methylbutanoyl]amino]pentanoyl]amino]phenyl]methyl N-[2-[acetyl(methyl)amino]ethyl]-N-methylcarbamate (PubChem CID 163368952) has the molecular formula C25H42N8O6 and a molecular weight of 550.66 g/mol. Its IUPAC name is [4-[[(2S)-5-(carbamoylamino)-2-[[(2S)-2-hydrazinyl-3-methylbutanoyl]amino]pentanoyl]amino]phenyl]methyl N-[2-[acetyl(methyl)amino]ethyl]-N-methylcarbamate.
| Compound Name | [4-[[(2S)-5-(carbamoylamino)-2-[[(2S)-2-hydrazinyl-3-methylbutanoyl]amino]pentanoyl]amino]phenyl]methyl N-[2-[acetyl(methyl)amino]ethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 163368952 |
| Molecular Formula | C25H42N8O6 |
| Molecular Weight | 550.66 g/mol |
| Exact Mass | 550.32 |
| IUPAC Name | [4-[[(2S)-5-(carbamoylamino)-2-[[(2S)-2-hydrazinyl-3-methylbutanoyl]amino]pentanoyl]amino]phenyl]methyl N-[2-[acetyl(methyl)amino]ethyl]-N-methylcarbamate |
| SMILES | CC(=O)N(C)CCN(C)C(=O)OCc1ccc(NC(=O)[C@H](CCCNC(N)=O)NC(=O)[C@@H](NN)C(C)C)cc1 |
| InChI | InChI=1S/C25H42N8O6/c1-16(2)21(31-27)23(36)30-20(7-6-12-28-24(26)37)22(35)29-19-10-8-18(9-11-19)15-39-25(38)33(5)14-13-32(4)17(3)34/h8-11,16,20-21,31H,6-7,12-15,27H2,1-5H3,(H,29,35)(H,30,36)(H3,26,28,37)/t20-,21-/m0/s1 |
| InChIKey | IINXSNVNNFXNKQ-SFTDATJTSA-N |
| XLogP | 0.09 |
| TPSA | 201.22 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.66 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|