C19H31NO2 — CID 118475732
butyl (2S)-3-methyl-2-[methyl-[2-(4-methylphenyl)ethyl]amino]butanoate (PubChem CID 118475732) has the molecular formula C19H31NO2 and a molecular weight of 305.46 g/mol. Its IUPAC name is butyl (2S)-3-methyl-2-[methyl-[2-(4-methylphenyl)ethyl]amino]butanoate.
| Compound Name | butyl (2S)-3-methyl-2-[methyl-[2-(4-methylphenyl)ethyl]amino]butanoate |
|---|---|
| PubChem CID | 118475732 |
| Molecular Formula | C19H31NO2 |
| Molecular Weight | 305.46 g/mol |
| Exact Mass | 305.24 |
| IUPAC Name | butyl (2S)-3-methyl-2-[methyl-[2-(4-methylphenyl)ethyl]amino]butanoate |
| SMILES | CCCCOC(=O)[C@H](C(C)C)N(C)CCc1ccc(C)cc1 |
| InChI | InChI=1S/C19H31NO2/c1-6-7-14-22-19(21)18(15(2)3)20(5)13-12-17-10-8-16(4)9-11-17/h8-11,15,18H,6-7,12-14H2,1-5H3/t18-/m0/s1 |
| InChIKey | IUIIMQBDHOPAKH-SFHVURJKSA-N |
| XLogP | 3.84 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.46 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|