C27H37BrN2O2Si — CID 11785863
benzyl (2S)-2-[[3-bromo-1-[tert-butyl(dimethyl)silyl]indol-4-yl]-methylamino]-3-methylbutanoate (PubChem CID 11785863) has the molecular formula C27H37BrN2O2Si and a molecular weight of 529.60 g/mol. Its IUPAC name is benzyl (2S)-2-[[3-bromo-1-[tert-butyl(dimethyl)silyl]indol-4-yl]-methylamino]-3-methylbutanoate.
| Compound Name | benzyl (2S)-2-[[3-bromo-1-[tert-butyl(dimethyl)silyl]indol-4-yl]-methylamino]-3-methylbutanoate |
|---|---|
| PubChem CID | 11785863 |
| Molecular Formula | C27H37BrN2O2Si |
| Molecular Weight | 529.60 g/mol |
| Exact Mass | 528.18 |
| IUPAC Name | benzyl (2S)-2-[[3-bromo-1-[tert-butyl(dimethyl)silyl]indol-4-yl]-methylamino]-3-methylbutanoate |
| SMILES | CC(C)[C@@H](C(=O)OCc1ccccc1)N(C)c1cccc2c1c(Br)cn2[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H37BrN2O2Si/c1-19(2)25(26(31)32-18-20-13-10-9-11-14-20)29(6)22-15-12-16-23-24(22)21(28)17-30(23)33(7,8)27(3,4)5/h9-17,19,25H,18H2,1-8H3/t25-/m0/s1 |
| InChIKey | IFUFTWMZWVFDKU-VWLOTQADSA-N |
| XLogP | 7.46 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.60 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|