C20H35ClN2OSSi2 — CID 167348834
tert-butyl-[3-[N-[tert-butyl(dimethyl)silyl]-S-chlorosulfonimidoyl]indol-1-yl]-dimethylsilane (PubChem CID 167348834) has the molecular formula C20H35ClN2OSSi2 and a molecular weight of 443.21 g/mol. Its IUPAC name is tert-butyl-[3-[N-[tert-butyl(dimethyl)silyl]-S-chlorosulfonimidoyl]indol-1-yl]-dimethylsilane.
| Compound Name | tert-butyl-[3-[N-[tert-butyl(dimethyl)silyl]-S-chlorosulfonimidoyl]indol-1-yl]-dimethylsilane |
|---|---|
| PubChem CID | 167348834 |
| Molecular Formula | C20H35ClN2OSSi2 |
| Molecular Weight | 443.21 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | tert-butyl-[3-[N-[tert-butyl(dimethyl)silyl]-S-chlorosulfonimidoyl]indol-1-yl]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)N=S(=O)(Cl)c1cn([Si](C)(C)C(C)(C)C)c2ccccc12 |
| InChI | InChI=1S/C20H35ClN2OSSi2/c1-19(2,3)26(7,8)22-25(21,24)18-15-23(27(9,10)20(4,5)6)17-14-12-11-13-16(17)18/h11-15H,1-10H3 |
| InChIKey | FFWMGAZFXBORSG-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.21 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|