About 1-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]indole-3-sulfonyl chloride
1-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]indole-3-sulfonyl chloride (PubChem CID 107915023) has the molecular formula C12H10ClN3O3S
and a molecular weight of 311.75 g/mol. Its IUPAC name is 1-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]indole-3-sulfonyl chloride.
Molecular Properties
| Compound Name | 1-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]indole-3-sulfonyl chloride |
| PubChem CID | 107915023 |
| Molecular Formula | C12H10ClN3O3S |
| Molecular Weight | 311.75 g/mol |
| Exact Mass | 311.01 |
| IUPAC Name | 1-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]indole-3-sulfonyl chloride |
| SMILES | Cc1nnc(Cn2cc(S(=O)(=O)Cl)c3ccccc32)o1 |
| InChI | InChI=1S/C12H10ClN3O3S/c1-8-14-15-12(19-8)7-16-6-11(20(13,17)18)9-4-2-3-5-10(9)16/h2-6H,7H2,1H3 |
| InChIKey | DAGYFVMZXUZRDJ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 77.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.75 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]indole-3-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]indole-3-sulfonyl chloride?
The IUPAC name of 1-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]indole-3-sulfonyl chloride (CID 107915023) is 1-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]indole-3-sulfonyl chloride.
What is the SMILES notation for 1-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]indole-3-sulfonyl chloride?
The canonical SMILES for 1-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]indole-3-sulfonyl chloride is Cc1nnc(Cn2cc(S(=O)(=O)Cl)c3ccccc32)o1.
What is the InChIKey of 1-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]indole-3-sulfonyl chloride?
The InChIKey is DAGYFVMZXUZRDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10ClN3O3S/c1-8-14-15-12(19-8)7-16-6-11(20(13,17)18)9-4-2-3-5-10(9)16/h2-6H,7H2,1H3.
What are the key properties of 1-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]indole-3-sulfonyl chloride?
1-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]indole-3-sulfonyl chloride has a molecular weight of 311.75 g/mol, XLogP of 2.31, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]indole-3-sulfonyl chloride is sourced from PubChem (CID 107915023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).