C11H8Cl3NO2S — CID 82915350
1-[(E)-2,3-dichloroprop-2-enyl]indole-3-sulfonyl chloride (PubChem CID 82915350) has the molecular formula C11H8Cl3NO2S and a molecular weight of 324.62 g/mol. Its IUPAC name is 1-[(E)-2,3-dichloroprop-2-enyl]indole-3-sulfonyl chloride.
| Compound Name | 1-[(E)-2,3-dichloroprop-2-enyl]indole-3-sulfonyl chloride |
|---|---|
| PubChem CID | 82915350 |
| Molecular Formula | C11H8Cl3NO2S |
| Molecular Weight | 324.62 g/mol |
| Exact Mass | 322.93 |
| IUPAC Name | 1-[(E)-2,3-dichloroprop-2-enyl]indole-3-sulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1cn(C/C(Cl)=C\Cl)c2ccccc12 |
| InChI | InChI=1S/C11H8Cl3NO2S/c12-5-8(13)6-15-7-11(18(14,16)17)9-3-1-2-4-10(9)15/h1-5,7H,6H2/b8-5+ |
| InChIKey | SXFGFNUFBCYKHJ-VMPITWQZSA-N |
| XLogP | 3.89 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.62 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |