C22H25ClN2O3S — CID 30560884
N-butyl-2-[3-[(4-chlorophenyl)methylsulfonyl]indol-1-yl]-N-methylacetamide (PubChem CID 30560884) has the molecular formula C22H25ClN2O3S and a molecular weight of 432.97 g/mol. Its IUPAC name is N-butyl-2-[3-[(4-chlorophenyl)methylsulfonyl]indol-1-yl]-N-methylacetamide.
| Compound Name | N-butyl-2-[3-[(4-chlorophenyl)methylsulfonyl]indol-1-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 30560884 |
| Molecular Formula | C22H25ClN2O3S |
| Molecular Weight | 432.97 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | N-butyl-2-[3-[(4-chlorophenyl)methylsulfonyl]indol-1-yl]-N-methylacetamide |
| SMILES | CCCCN(C)C(=O)Cn1cc(S(=O)(=O)Cc2ccc(Cl)cc2)c2ccccc21 |
| InChI | InChI=1S/C22H25ClN2O3S/c1-3-4-13-24(2)22(26)15-25-14-21(19-7-5-6-8-20(19)25)29(27,28)16-17-9-11-18(23)12-10-17/h5-12,14H,3-4,13,15-16H2,1-2H3 |
| InChIKey | BARFEIZFQIBKLY-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 59.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.97 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |