C13H14ClNO2S — CID 82914607
1-pent-4-enylindole-3-sulfonyl chloride (PubChem CID 82914607) has the molecular formula C13H14ClNO2S and a molecular weight of 283.78 g/mol. Its IUPAC name is 1-pent-4-enylindole-3-sulfonyl chloride.
| Compound Name | 1-pent-4-enylindole-3-sulfonyl chloride |
|---|---|
| PubChem CID | 82914607 |
| Molecular Formula | C13H14ClNO2S |
| Molecular Weight | 283.78 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | 1-pent-4-enylindole-3-sulfonyl chloride |
| SMILES | C=CCCCn1cc(S(=O)(=O)Cl)c2ccccc21 |
| InChI | InChI=1S/C13H14ClNO2S/c1-2-3-6-9-15-10-13(18(14,16)17)11-7-4-5-8-12(11)15/h2,4-5,7-8,10H,1,3,6,9H2 |
| InChIKey | ZAFQWOVNIAMSIP-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.78 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|