C25H27NO — CID 164614068
(2,2-dimethyl-1,3-dihydroinden-5-yl)-(1-pent-4-enylindol-3-yl)methanone (PubChem CID 164614068) has the molecular formula C25H27NO and a molecular weight of 357.50 g/mol. Its IUPAC name is (2,2-dimethyl-1,3-dihydroinden-5-yl)-(1-pent-4-enylindol-3-yl)methanone.
| Compound Name | (2,2-dimethyl-1,3-dihydroinden-5-yl)-(1-pent-4-enylindol-3-yl)methanone |
|---|---|
| PubChem CID | 164614068 |
| Molecular Formula | C25H27NO |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | (2,2-dimethyl-1,3-dihydroinden-5-yl)-(1-pent-4-enylindol-3-yl)methanone |
| SMILES | C=CCCCn1cc(C(=O)c2ccc3c(c2)CC(C)(C)C3)c2ccccc21 |
| InChI | InChI=1S/C25H27NO/c1-4-5-8-13-26-17-22(21-9-6-7-10-23(21)26)24(27)18-11-12-19-15-25(2,3)16-20(19)14-18/h4,6-7,9-12,14,17H,1,5,8,13,15-16H2,2-3H3 |
| InChIKey | DXCWNRKMBBQZCR-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|