About [(chloro-oxo-phenyl-λ6-sulfanylidene)amino]-trimethylsilane
[(chloro-oxo-phenyl-λ6-sulfanylidene)amino]-trimethylsilane (PubChem CID 129405304) has the molecular formula C9H14ClNOSSi
and a molecular weight of 247.82 g/mol. Its IUPAC name is [(chloro-oxo-phenyl-λ6-sulfanylidene)amino]-trimethylsilane.
Molecular Properties
| Compound Name | [(chloro-oxo-phenyl-λ6-sulfanylidene)amino]-trimethylsilane |
| PubChem CID | 129405304 |
| Molecular Formula | C9H14ClNOSSi |
| Molecular Weight | 247.82 g/mol |
| Exact Mass | 247.03 |
| IUPAC Name | [(chloro-oxo-phenyl-λ6-sulfanylidene)amino]-trimethylsilane |
| SMILES | C[Si](C)(C)N=[S@@](=O)(Cl)c1ccccc1 |
| InChI | InChI=1S/C9H14ClNOSSi/c1-14(2,3)11-13(10,12)9-7-5-4-6-8-9/h4-8H,1-3H3/t13-/m0/s1 |
| InChIKey | ZUMMGYMMVYGNLG-ZDUSSCGKSA-N |
| XLogP | 3.50 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.82 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(chloro-oxo-phenyl-λ6-sulfanylidene)amino]-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(chloro-oxo-phenyl-λ6-sulfanylidene)amino]-trimethylsilane?
The IUPAC name of [(chloro-oxo-phenyl-λ6-sulfanylidene)amino]-trimethylsilane (CID 129405304) is [(chloro-oxo-phenyl-λ6-sulfanylidene)amino]-trimethylsilane.
What is the SMILES notation for [(chloro-oxo-phenyl-λ6-sulfanylidene)amino]-trimethylsilane?
The canonical SMILES for [(chloro-oxo-phenyl-λ6-sulfanylidene)amino]-trimethylsilane is C[Si](C)(C)N=[S@@](=O)(Cl)c1ccccc1.
What is the InChIKey of [(chloro-oxo-phenyl-λ6-sulfanylidene)amino]-trimethylsilane?
The InChIKey is ZUMMGYMMVYGNLG-ZDUSSCGKSA-N. The full InChI is InChI=1S/C9H14ClNOSSi/c1-14(2,3)11-13(10,12)9-7-5-4-6-8-9/h4-8H,1-3H3/t13-/m0/s1.
What are the key properties of [(chloro-oxo-phenyl-λ6-sulfanylidene)amino]-trimethylsilane?
[(chloro-oxo-phenyl-λ6-sulfanylidene)amino]-trimethylsilane has a molecular weight of 247.82 g/mol, XLogP of 3.50, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(chloro-oxo-phenyl-λ6-sulfanylidene)amino]-trimethylsilane is sourced from PubChem (CID 129405304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).