C14H23F2NOSSi — CID 146029337
tert-butyl-[(1,1-difluoroethyl-oxo-phenyl-λ6-sulfanylidene)amino]-dimethylsilane (PubChem CID 146029337) has the molecular formula C14H23F2NOSSi and a molecular weight of 319.49 g/mol. Its IUPAC name is tert-butyl-[(1,1-difluoroethyl-oxo-phenyl-λ6-sulfanylidene)amino]-dimethylsilane.
| Compound Name | tert-butyl-[(1,1-difluoroethyl-oxo-phenyl-λ6-sulfanylidene)amino]-dimethylsilane |
|---|---|
| PubChem CID | 146029337 |
| Molecular Formula | C14H23F2NOSSi |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | tert-butyl-[(1,1-difluoroethyl-oxo-phenyl-λ6-sulfanylidene)amino]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)N=[S@](=O)(c1ccccc1)C(C)(F)F |
| InChI | InChI=1S/C14H23F2NOSSi/c1-13(2,3)20(5,6)17-19(18,14(4,15)16)12-10-8-7-9-11-12/h7-11H,1-6H3/t19-/m0/s1 |
| InChIKey | LOLCTJKQCUKXJJ-IBGZPJMESA-N |
| XLogP | 5.13 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|