C8H5Cl2F4NO3S2 — CID 56590770
N-[[dichloro(fluoro)methyl]-oxo-phenyl-λ6-sulfanylidene]-1,1,1-trifluoromethanesulfonamide (PubChem CID 56590770) has the molecular formula C8H5Cl2F4NO3S2 and a molecular weight of 374.16 g/mol. Its IUPAC name is N-[[dichloro(fluoro)methyl]-oxo-phenyl-λ6-sulfanylidene]-1,1,1-trifluoromethanesulfonamide.
| Compound Name | N-[[dichloro(fluoro)methyl]-oxo-phenyl-λ6-sulfanylidene]-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 56590770 |
| Molecular Formula | C8H5Cl2F4NO3S2 |
| Molecular Weight | 374.16 g/mol |
| Exact Mass | 372.90 |
| IUPAC Name | N-[[dichloro(fluoro)methyl]-oxo-phenyl-λ6-sulfanylidene]-1,1,1-trifluoromethanesulfonamide |
| SMILES | O=S(=O)(N=S(=O)(c1ccccc1)C(F)(Cl)Cl)C(F)(F)F |
| InChI | InChI=1S/C8H5Cl2F4NO3S2/c9-7(10,11)19(16,6-4-2-1-3-5-6)15-20(17,18)8(12,13)14/h1-5H |
| InChIKey | URORZKXYDGKGPD-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 63.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.16 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|