C8H21NOSSi — CID 162396856
tert-butyl-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-dimethylsilane (PubChem CID 162396856) has the molecular formula C8H21NOSSi and a molecular weight of 207.41 g/mol. Its IUPAC name is tert-butyl-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-dimethylsilane.
| Compound Name | tert-butyl-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-dimethylsilane |
|---|---|
| PubChem CID | 162396856 |
| Molecular Formula | C8H21NOSSi |
| Molecular Weight | 207.41 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | tert-butyl-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)N=S(C)(C)=O |
| InChI | InChI=1S/C8H21NOSSi/c1-8(2,3)12(6,7)9-11(4,5)10/h1-7H3 |
| InChIKey | UWXUSRKKAFDZNU-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.41 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|