C13H26N2OS2Si — CID 150684916
2-[S-amino-N-[tert-butyl(dimethyl)silyl]sulfonimidoyl]-4-propan-2-ylthiophene (PubChem CID 150684916) has the molecular formula C13H26N2OS2Si and a molecular weight of 318.58 g/mol. Its IUPAC name is 2-[S-amino-N-[tert-butyl(dimethyl)silyl]sulfonimidoyl]-4-propan-2-ylthiophene.
| Compound Name | 2-[S-amino-N-[tert-butyl(dimethyl)silyl]sulfonimidoyl]-4-propan-2-ylthiophene |
|---|---|
| PubChem CID | 150684916 |
| Molecular Formula | C13H26N2OS2Si |
| Molecular Weight | 318.58 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | 2-[S-amino-N-[tert-butyl(dimethyl)silyl]sulfonimidoyl]-4-propan-2-ylthiophene |
| SMILES | CC(C)c1csc(S(N)(=O)=N[Si](C)(C)C(C)(C)C)c1 |
| InChI | InChI=1S/C13H26N2OS2Si/c1-10(2)11-8-12(17-9-11)18(14,16)15-19(6,7)13(3,4)5/h8-10H,1-7H3,(H2,14,15,16) |
| InChIKey | JIQONHRSANKUSZ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.58 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|