C9H25N3OSSi — CID 154587020
N'-[N-[tert-butyl(dimethyl)silyl]-S-methylsulfonimidoyl]ethane-1,2-diamine (PubChem CID 154587020) has the molecular formula C9H25N3OSSi and a molecular weight of 251.47 g/mol. Its IUPAC name is N'-[N-[tert-butyl(dimethyl)silyl]-S-methylsulfonimidoyl]ethane-1,2-diamine.
| Compound Name | N'-[N-[tert-butyl(dimethyl)silyl]-S-methylsulfonimidoyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 154587020 |
| Molecular Formula | C9H25N3OSSi |
| Molecular Weight | 251.47 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | N'-[N-[tert-butyl(dimethyl)silyl]-S-methylsulfonimidoyl]ethane-1,2-diamine |
| SMILES | CC(C)(C)[Si](C)(C)N=S(C)(=O)NCCN |
| InChI | InChI=1S/C9H25N3OSSi/c1-9(2,3)15(5,6)12-14(4,13)11-8-7-10/h7-8,10H2,1-6H3,(H,11,12,13) |
| InChIKey | MQPZONRLCNZBHM-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.47 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|