C7H12F2N4O2S — CID 19621228
N-(2-aminoethyl)-1-(difluoromethyl)-5-methylpyrazole-4-sulfonamide (PubChem CID 19621228) has the molecular formula C7H12F2N4O2S and a molecular weight of 254.26 g/mol. Its IUPAC name is N-(2-aminoethyl)-1-(difluoromethyl)-5-methylpyrazole-4-sulfonamide.
| Compound Name | N-(2-aminoethyl)-1-(difluoromethyl)-5-methylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 19621228 |
| Molecular Formula | C7H12F2N4O2S |
| Molecular Weight | 254.26 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | N-(2-aminoethyl)-1-(difluoromethyl)-5-methylpyrazole-4-sulfonamide |
| SMILES | Cc1c(S(=O)(=O)NCCN)cnn1C(F)F |
| InChI | InChI=1S/C7H12F2N4O2S/c1-5-6(4-11-13(5)7(8)9)16(14,15)12-3-2-10/h4,7,12H,2-3,10H2,1H3 |
| InChIKey | GVPCQBSAUVXDSU-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.26 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |