C20H26FNO2SSi — CID 102346704
2-[N-[tert-butyl(dimethyl)silyl]-S-phenylsulfonimidoyl]-2-fluoro-1-phenylethanone (PubChem CID 102346704) has the molecular formula C20H26FNO2SSi and a molecular weight of 391.58 g/mol. Its IUPAC name is 2-[N-[tert-butyl(dimethyl)silyl]-S-phenylsulfonimidoyl]-2-fluoro-1-phenylethanone.
| Compound Name | 2-[N-[tert-butyl(dimethyl)silyl]-S-phenylsulfonimidoyl]-2-fluoro-1-phenylethanone |
|---|---|
| PubChem CID | 102346704 |
| Molecular Formula | C20H26FNO2SSi |
| Molecular Weight | 391.58 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 2-[N-[tert-butyl(dimethyl)silyl]-S-phenylsulfonimidoyl]-2-fluoro-1-phenylethanone |
| SMILES | CC(C)(C)[Si](C)(C)N=S(=O)(c1ccccc1)C(F)C(=O)c1ccccc1 |
| InChI | InChI=1S/C20H26FNO2SSi/c1-20(2,3)26(4,5)22-25(24,17-14-10-7-11-15-17)19(21)18(23)16-12-8-6-9-13-16/h6-15,19H,1-5H3 |
| InChIKey | CVRJDVVTBAWPGO-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.58 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|