C17H22ClNOSSi — CID 154660343
tert-butyl-[(chloro-methyl-oxo-λ6-sulfanylidene)amino]-diphenylsilane (PubChem CID 154660343) has the molecular formula C17H22ClNOSSi and a molecular weight of 351.98 g/mol. Its IUPAC name is tert-butyl-[(chloro-methyl-oxo-λ6-sulfanylidene)amino]-diphenylsilane.
| Compound Name | tert-butyl-[(chloro-methyl-oxo-λ6-sulfanylidene)amino]-diphenylsilane |
|---|---|
| PubChem CID | 154660343 |
| Molecular Formula | C17H22ClNOSSi |
| Molecular Weight | 351.98 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | tert-butyl-[(chloro-methyl-oxo-λ6-sulfanylidene)amino]-diphenylsilane |
| SMILES | CC(C)(C)[Si](N=S(C)(=O)Cl)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H22ClNOSSi/c1-17(2,3)22(19-21(4,18)20,15-11-7-5-8-12-15)16-13-9-6-10-14-16/h5-14H,1-4H3 |
| InChIKey | YOKFWYRWZDKOKS-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.98 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|