C33H45NO2SSi — CID 25035068
cis-(1S,2S)-2-tert-butyl-1-[[N-[tert-butyl(diphenyl)silyl]-S-phenylsulfonimidoyl]methyl]cyclohexan-1-ol (PubChem CID 25035068) has the molecular formula C33H45NO2SSi and a molecular weight of 547.88 g/mol. Its IUPAC name is cis-(1S,2S)-2-tert-butyl-1-[[N-[tert-butyl(diphenyl)silyl]-S-phenylsulfonimidoyl]methyl]cyclohexan-1-ol.
| Compound Name | cis-(1S,2S)-2-tert-butyl-1-[[N-[tert-butyl(diphenyl)silyl]-S-phenylsulfonimidoyl]methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 25035068 |
| Molecular Formula | C33H45NO2SSi |
| Molecular Weight | 547.88 g/mol |
| Exact Mass | 547.29 |
| IUPAC Name | cis-(1S,2S)-2-tert-butyl-1-[[N-[tert-butyl(diphenyl)silyl]-S-phenylsulfonimidoyl]methyl]cyclohexan-1-ol |
| SMILES | CC(C)(C)[C@@H]1CCCC[C@@]1(O)C[S@@](=O)(=N[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C33H45NO2SSi/c1-31(2,3)30-24-16-17-25-33(30,35)26-37(36,27-18-10-7-11-19-27)34-38(32(4,5)6,28-20-12-8-13-21-28)29-22-14-9-15-23-29/h7-15,18-23,30,35H,16-17,24-26H2,1-6H3/t30-,33+,37-/m0/s1 |
| InChIKey | JSGOFLIHZMKEEW-FEZYOPNHSA-N |
| XLogP | 7.04 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.88 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|