C21H28N2O2SSi — CID 167317088
1-[tert-butyl(diphenyl)silyl]imino-4,4-dimethyl-1-oxo-1,2-thiazolidin-3-one (PubChem CID 167317088) has the molecular formula C21H28N2O2SSi and a molecular weight of 400.62 g/mol. Its IUPAC name is 1-[tert-butyl(diphenyl)silyl]imino-4,4-dimethyl-1-oxo-1,2-thiazolidin-3-one.
| Compound Name | 1-[tert-butyl(diphenyl)silyl]imino-4,4-dimethyl-1-oxo-1,2-thiazolidin-3-one |
|---|---|
| PubChem CID | 167317088 |
| Molecular Formula | C21H28N2O2SSi |
| Molecular Weight | 400.62 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 1-[tert-butyl(diphenyl)silyl]imino-4,4-dimethyl-1-oxo-1,2-thiazolidin-3-one |
| SMILES | CC1(C)CS(=O)(=N[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)NC1=O |
| InChI | InChI=1S/C21H28N2O2SSi/c1-20(2,3)27(17-12-8-6-9-13-17,18-14-10-7-11-15-18)23-26(25)16-21(4,5)19(24)22-26/h6-15H,16H2,1-5H3,(H,22,23,24,25) |
| InChIKey | VLFZGTPEMYLUNT-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.62 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|