C30H24O4S — CID 58133164
1-[4-(4-methylphenyl)sulfonylphenoxy]-5-phenylmethoxynaphthalene (PubChem CID 58133164) has the molecular formula C30H24O4S and a molecular weight of 480.59 g/mol. Its IUPAC name is 1-[4-(4-methylphenyl)sulfonylphenoxy]-5-phenylmethoxynaphthalene.
| Compound Name | 1-[4-(4-methylphenyl)sulfonylphenoxy]-5-phenylmethoxynaphthalene |
|---|---|
| PubChem CID | 58133164 |
| Molecular Formula | C30H24O4S |
| Molecular Weight | 480.59 g/mol |
| Exact Mass | 480.14 |
| IUPAC Name | 1-[4-(4-methylphenyl)sulfonylphenoxy]-5-phenylmethoxynaphthalene |
| SMILES | Cc1ccc(S(=O)(=O)c2ccc(Oc3cccc4c(OCc5ccccc5)cccc34)cc2)cc1 |
| InChI | InChI=1S/C30H24O4S/c1-22-13-17-25(18-14-22)35(31,32)26-19-15-24(16-20-26)34-30-12-6-9-27-28(30)10-5-11-29(27)33-21-23-7-3-2-4-8-23/h2-20H,21H2,1H3 |
| InChIKey | WMHBTBNYTDPPEE-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.59 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |