C24H33FN2O3SSi — CID 176845478
2-[tert-butyl(dimethyl)silyl]oxy-N-[[6-fluoro-1-(4-methylphenyl)sulfonylindol-4-yl]methyl]ethanamine (PubChem CID 176845478) has the molecular formula C24H33FN2O3SSi and a molecular weight of 476.69 g/mol. Its IUPAC name is 2-[tert-butyl(dimethyl)silyl]oxy-N-[[6-fluoro-1-(4-methylphenyl)sulfonylindol-4-yl]methyl]ethanamine.
| Compound Name | 2-[tert-butyl(dimethyl)silyl]oxy-N-[[6-fluoro-1-(4-methylphenyl)sulfonylindol-4-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 176845478 |
| Molecular Formula | C24H33FN2O3SSi |
| Molecular Weight | 476.69 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | 2-[tert-butyl(dimethyl)silyl]oxy-N-[[6-fluoro-1-(4-methylphenyl)sulfonylindol-4-yl]methyl]ethanamine |
| SMILES | Cc1ccc(S(=O)(=O)n2ccc3c(CNCCO[Si](C)(C)C(C)(C)C)cc(F)cc32)cc1 |
| InChI | InChI=1S/C24H33FN2O3SSi/c1-18-7-9-21(10-8-18)31(28,29)27-13-11-22-19(15-20(25)16-23(22)27)17-26-12-14-30-32(5,6)24(2,3)4/h7-11,13,15-16,26H,12,14,17H2,1-6H3 |
| InChIKey | AKAIWIGENNDCPE-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.69 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|