C30H36N2O4SSi — CID 138983524
N-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-(4-methylphenyl)sulfonylindol-3-yl]-2-phenylacetamide (PubChem CID 138983524) has the molecular formula C30H36N2O4SSi and a molecular weight of 548.78 g/mol. Its IUPAC name is N-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-(4-methylphenyl)sulfonylindol-3-yl]-2-phenylacetamide.
| Compound Name | N-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-(4-methylphenyl)sulfonylindol-3-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 138983524 |
| Molecular Formula | C30H36N2O4SSi |
| Molecular Weight | 548.78 g/mol |
| Exact Mass | 548.22 |
| IUPAC Name | N-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-(4-methylphenyl)sulfonylindol-3-yl]-2-phenylacetamide |
| SMILES | Cc1ccc(S(=O)(=O)n2c(CO[Si](C)(C)C(C)(C)C)c(NC(=O)Cc3ccccc3)c3ccccc32)cc1 |
| InChI | InChI=1S/C30H36N2O4SSi/c1-22-16-18-24(19-17-22)37(34,35)32-26-15-11-10-14-25(26)29(27(32)21-36-38(5,6)30(2,3)4)31-28(33)20-23-12-8-7-9-13-23/h7-19H,20-21H2,1-6H3,(H,31,33) |
| InChIKey | RRNLCWSVRHHQPA-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.78 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|