C18H17N3O5S2 — CID 24947555
1-(benzenesulfonyl)-4-cyano-N-(2-methoxyethyl)indole-3-sulfonamide (PubChem CID 24947555) has the molecular formula C18H17N3O5S2 and a molecular weight of 419.48 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-4-cyano-N-(2-methoxyethyl)indole-3-sulfonamide.
| Compound Name | 1-(benzenesulfonyl)-4-cyano-N-(2-methoxyethyl)indole-3-sulfonamide |
|---|---|
| PubChem CID | 24947555 |
| Molecular Formula | C18H17N3O5S2 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.06 |
| IUPAC Name | 1-(benzenesulfonyl)-4-cyano-N-(2-methoxyethyl)indole-3-sulfonamide |
| SMILES | COCCNS(=O)(=O)c1cn(S(=O)(=O)c2ccccc2)c2cccc(C#N)c12 |
| InChI | InChI=1S/C18H17N3O5S2/c1-26-11-10-20-27(22,23)17-13-21(16-9-5-6-14(12-19)18(16)17)28(24,25)15-7-3-2-4-8-15/h2-9,13,20H,10-11H2,1H3 |
| InChIKey | WETCELFSPUJVEF-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 118.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|