C24H30N2O5S2 — CID 24946119
1-(benzenesulfonyl)-N-[2-(oxan-4-yl)ethyl]-4-propan-2-ylindole-3-sulfonamide (PubChem CID 24946119) has the molecular formula C24H30N2O5S2 and a molecular weight of 490.65 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-N-[2-(oxan-4-yl)ethyl]-4-propan-2-ylindole-3-sulfonamide.
| Compound Name | 1-(benzenesulfonyl)-N-[2-(oxan-4-yl)ethyl]-4-propan-2-ylindole-3-sulfonamide |
|---|---|
| PubChem CID | 24946119 |
| Molecular Formula | C24H30N2O5S2 |
| Molecular Weight | 490.65 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | 1-(benzenesulfonyl)-N-[2-(oxan-4-yl)ethyl]-4-propan-2-ylindole-3-sulfonamide |
| SMILES | CC(C)c1cccc2c1c(S(=O)(=O)NCCC1CCOCC1)cn2S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C24H30N2O5S2/c1-18(2)21-9-6-10-22-24(21)23(17-26(22)33(29,30)20-7-4-3-5-8-20)32(27,28)25-14-11-19-12-15-31-16-13-19/h3-10,17-19,25H,11-16H2,1-2H3 |
| InChIKey | NMQXSWIUSRTGCN-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 94.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.65 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |