C21H22F3N3O4S2 — CID 24947737
N-(4-aminocyclohexyl)-1-(benzenesulfonyl)-4-(trifluoromethyl)indole-3-sulfonamide (PubChem CID 24947737) has the molecular formula C21H22F3N3O4S2 and a molecular weight of 501.55 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-1-(benzenesulfonyl)-4-(trifluoromethyl)indole-3-sulfonamide.
| Compound Name | N-(4-aminocyclohexyl)-1-(benzenesulfonyl)-4-(trifluoromethyl)indole-3-sulfonamide |
|---|---|
| PubChem CID | 24947737 |
| Molecular Formula | C21H22F3N3O4S2 |
| Molecular Weight | 501.55 g/mol |
| Exact Mass | 501.10 |
| IUPAC Name | N-(4-aminocyclohexyl)-1-(benzenesulfonyl)-4-(trifluoromethyl)indole-3-sulfonamide |
| SMILES | NC1CCC(NS(=O)(=O)c2cn(S(=O)(=O)c3ccccc3)c3cccc(C(F)(F)F)c23)CC1 |
| InChI | InChI=1S/C21H22F3N3O4S2/c22-21(23,24)17-7-4-8-18-20(17)19(32(28,29)26-15-11-9-14(25)10-12-15)13-27(18)33(30,31)16-5-2-1-3-6-16/h1-8,13-15,26H,9-12,25H2 |
| InChIKey | BPTYPXNGCQYVSP-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 111.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.55 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |