C23H22F3N3O7S2 — CID 24948104
methyl 2-[4-[[1-(benzenesulfonyl)-4-(trifluoromethyl)indol-3-yl]sulfonylamino]piperidin-1-yl]-2-oxoacetate (PubChem CID 24948104) has the molecular formula C23H22F3N3O7S2 and a molecular weight of 573.57 g/mol. Its IUPAC name is methyl 2-[4-[[1-(benzenesulfonyl)-4-(trifluoromethyl)indol-3-yl]sulfonylamino]piperidin-1-yl]-2-oxoacetate.
| Compound Name | methyl 2-[4-[[1-(benzenesulfonyl)-4-(trifluoromethyl)indol-3-yl]sulfonylamino]piperidin-1-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 24948104 |
| Molecular Formula | C23H22F3N3O7S2 |
| Molecular Weight | 573.57 g/mol |
| Exact Mass | 573.09 |
| IUPAC Name | methyl 2-[4-[[1-(benzenesulfonyl)-4-(trifluoromethyl)indol-3-yl]sulfonylamino]piperidin-1-yl]-2-oxoacetate |
| SMILES | COC(=O)C(=O)N1CCC(NS(=O)(=O)c2cn(S(=O)(=O)c3ccccc3)c3cccc(C(F)(F)F)c23)CC1 |
| InChI | InChI=1S/C23H22F3N3O7S2/c1-36-22(31)21(30)28-12-10-15(11-13-28)27-37(32,33)19-14-29(38(34,35)16-6-3-2-4-7-16)18-9-5-8-17(20(18)19)23(24,25)26/h2-9,14-15,27H,10-13H2,1H3 |
| InChIKey | GOKBLAXSGDXOBD-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 131.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.57 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|