C14H16F3N2O5S- — CID 154237982
4-[[4-methoxy-2-(trifluoromethyl)phenyl]sulfonylamino]piperidine-1-carboxylate (PubChem CID 154237982) has the molecular formula C14H16F3N2O5S- and a molecular weight of 381.35 g/mol. Its IUPAC name is 4-[[4-methoxy-2-(trifluoromethyl)phenyl]sulfonylamino]piperidine-1-carboxylate.
| Compound Name | 4-[[4-methoxy-2-(trifluoromethyl)phenyl]sulfonylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 154237982 |
| Molecular Formula | C14H16F3N2O5S- |
| Molecular Weight | 381.35 g/mol |
| Exact Mass | 381.07 |
| IUPAC Name | 4-[[4-methoxy-2-(trifluoromethyl)phenyl]sulfonylamino]piperidine-1-carboxylate |
| SMILES | COc1ccc(S(=O)(=O)NC2CCN(C(=O)[O-])CC2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H17F3N2O5S/c1-24-10-2-3-12(11(8-10)14(15,16)17)25(22,23)18-9-4-6-19(7-5-9)13(20)21/h2-3,8-9,18H,4-7H2,1H3,(H,20,21)/p-1 |
| InChIKey | VDWQXIKJDBFHDE-UHFFFAOYSA-M |
| XLogP | 0.80 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.35 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |