C20H22F3N3O3S — CID 69167156
N-[1-(2-aminoacetyl)piperidin-4-yl]-4-phenyl-2-(trifluoromethyl)benzenesulfonamide (PubChem CID 69167156) has the molecular formula C20H22F3N3O3S and a molecular weight of 441.48 g/mol. Its IUPAC name is N-[1-(2-aminoacetyl)piperidin-4-yl]-4-phenyl-2-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[1-(2-aminoacetyl)piperidin-4-yl]-4-phenyl-2-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 69167156 |
| Molecular Formula | C20H22F3N3O3S |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | N-[1-(2-aminoacetyl)piperidin-4-yl]-4-phenyl-2-(trifluoromethyl)benzenesulfonamide |
| SMILES | NCC(=O)N1CCC(NS(=O)(=O)c2ccc(-c3ccccc3)cc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C20H22F3N3O3S/c21-20(22,23)17-12-15(14-4-2-1-3-5-14)6-7-18(17)30(28,29)25-16-8-10-26(11-9-16)19(27)13-24/h1-7,12,16,25H,8-11,13,24H2 |
| InChIKey | CPMRFPZOYUOAPZ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |