C22H26N2O5S2 — CID 24946816
1-(benzenesulfonyl)-4-ethyl-N-(oxan-4-ylmethyl)indole-3-sulfonamide (PubChem CID 24946816) has the molecular formula C22H26N2O5S2 and a molecular weight of 462.59 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-4-ethyl-N-(oxan-4-ylmethyl)indole-3-sulfonamide.
| Compound Name | 1-(benzenesulfonyl)-4-ethyl-N-(oxan-4-ylmethyl)indole-3-sulfonamide |
|---|---|
| PubChem CID | 24946816 |
| Molecular Formula | C22H26N2O5S2 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | 1-(benzenesulfonyl)-4-ethyl-N-(oxan-4-ylmethyl)indole-3-sulfonamide |
| SMILES | CCc1cccc2c1c(S(=O)(=O)NCC1CCOCC1)cn2S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C22H26N2O5S2/c1-2-18-7-6-10-20-22(18)21(30(25,26)23-15-17-11-13-29-14-12-17)16-24(20)31(27,28)19-8-4-3-5-9-19/h3-10,16-17,23H,2,11-15H2,1H3 |
| InChIKey | HTOITDMSHBUGQV-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 94.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |