C16H15NO5S2 — CID 87727667
1-(benzenesulfonyl)-4-ethylindole-3-sulfonic acid (PubChem CID 87727667) has the molecular formula C16H15NO5S2 and a molecular weight of 365.43 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-4-ethylindole-3-sulfonic acid.
| Compound Name | 1-(benzenesulfonyl)-4-ethylindole-3-sulfonic acid |
|---|---|
| PubChem CID | 87727667 |
| Molecular Formula | C16H15NO5S2 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.04 |
| IUPAC Name | 1-(benzenesulfonyl)-4-ethylindole-3-sulfonic acid |
| SMILES | CCc1cccc2c1c(S(=O)(=O)O)cn2S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H15NO5S2/c1-2-12-7-6-10-14-16(12)15(24(20,21)22)11-17(14)23(18,19)13-8-4-3-5-9-13/h3-11H,2H2,1H3,(H,20,21,22) |
| InChIKey | ABOBLPOFIWKWFE-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 93.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|