C15H13NO6S2 — CID 90935850
1-(benzenesulfonyl)-7-methoxyindole-3-sulfonic acid (PubChem CID 90935850) has the molecular formula C15H13NO6S2 and a molecular weight of 367.40 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-7-methoxyindole-3-sulfonic acid.
| Compound Name | 1-(benzenesulfonyl)-7-methoxyindole-3-sulfonic acid |
|---|---|
| PubChem CID | 90935850 |
| Molecular Formula | C15H13NO6S2 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.02 |
| IUPAC Name | 1-(benzenesulfonyl)-7-methoxyindole-3-sulfonic acid |
| SMILES | COc1cccc2c(S(=O)(=O)O)cn(S(=O)(=O)c3ccccc3)c12 |
| InChI | InChI=1S/C15H13NO6S2/c1-22-13-9-5-8-12-14(24(19,20)21)10-16(15(12)13)23(17,18)11-6-3-2-4-7-11/h2-10H,1H3,(H,19,20,21) |
| InChIKey | ZRXZATHRYOTCQX-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 102.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|