C16H15NO2S — CID 123930016
1-(benzenesulfonyl)-3,7-dimethylindole (PubChem CID 123930016) has the molecular formula C16H15NO2S and a molecular weight of 285.37 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-3,7-dimethylindole.
| Compound Name | 1-(benzenesulfonyl)-3,7-dimethylindole |
|---|---|
| PubChem CID | 123930016 |
| Molecular Formula | C16H15NO2S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 1-(benzenesulfonyl)-3,7-dimethylindole |
| SMILES | Cc1cn(S(=O)(=O)c2ccccc2)c2c(C)cccc12 |
| InChI | InChI=1S/C16H15NO2S/c1-12-7-6-10-15-13(2)11-17(16(12)15)20(18,19)14-8-4-3-5-9-14/h3-11H,1-2H3 |
| InChIKey | DLBFYCMJLSUFQL-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |