C13H14N2O4S — CID 86241037
3-[2-(2-methoxyethoxy)ethylsulfonyl]benzene-1,2-dicarbonitrile (PubChem CID 86241037) has the molecular formula C13H14N2O4S and a molecular weight of 294.33 g/mol. Its IUPAC name is 3-[2-(2-methoxyethoxy)ethylsulfonyl]benzene-1,2-dicarbonitrile.
| Compound Name | 3-[2-(2-methoxyethoxy)ethylsulfonyl]benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 86241037 |
| Molecular Formula | C13H14N2O4S |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 3-[2-(2-methoxyethoxy)ethylsulfonyl]benzene-1,2-dicarbonitrile |
| SMILES | COCCOCCS(=O)(=O)c1cccc(C#N)c1C#N |
| InChI | InChI=1S/C13H14N2O4S/c1-18-5-6-19-7-8-20(16,17)13-4-2-3-11(9-14)12(13)10-15/h2-4H,5-8H2,1H3 |
| InChIKey | SMPNQQRDWGEJDJ-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 100.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|